C30H30N4O4S2 — CID 90145831
N-(oxolan-2-ylmethyl)-8-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]quinoline-5-carboxamide (PubChem CID 90145831) has the molecular formula C30H30N4O4S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-8-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]quinoline-5-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-8-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 90145831 |
| Molecular Formula | C30H30N4O4S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-8-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]quinoline-5-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(SSc2ccc(C(=O)NCC3CCCO3)c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C30H30N4O4S2/c35-29(33-17-19-5-3-15-37-19)23-9-11-25(27-21(23)7-1-13-31-27)39-40-26-12-10-24(22-8-2-14-32-28(22)26)30(36)34-18-20-6-4-16-38-20/h1-2,7-14,19-20H,3-6,15-18H2,(H,33,35)(H,34,36) |
| InChIKey | AZNRGDNFBUESHC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|