C25H31N5O8S2 — CID 74763529
(2R)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 74763529) has the molecular formula C25H31N5O8S2 and a molecular weight of 593.68 g/mol. Its IUPAC name is (2R)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 74763529 |
| Molecular Formula | C25H31N5O8S2 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | (2R)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-[[5-(oxolan-2-ylmethylcarbamoyl)quinolin-8-yl]disulfanyl]propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@H](CCC(=O)N[C@H](CSSc1ccc(C(=O)NCC2CCCO2)c2cccnc12)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H31N5O8S2/c26-17(25(36)37)6-8-20(31)30-18(24(35)29-12-21(32)33)13-39-40-19-7-5-16(15-4-1-9-27-22(15)19)23(34)28-11-14-3-2-10-38-14/h1,4-5,7,9,14,17-18H,2-3,6,8,10-13,26H2,(H,28,34)(H,29,35)(H,30,31)(H,32,33)(H,36,37)/t14?,17-,18-/m1/s1 |
| InChIKey | UCZXRHAOWKBUPR-KNHHTTPFSA-N |
| XLogP | 0.76 |
| TPSA | 210.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|