C36H42N8O6S2 — CID 90112937
N-[(5S)-5-acetamido-6-amino-6-oxohexyl]-8-[[4-[[(5R)-5-acetamido-6-amino-6-oxohexyl]carbamoyl]quinolin-8-yl]disulfanyl]quinoline-4-carboxamide (PubChem CID 90112937) has the molecular formula C36H42N8O6S2 and a molecular weight of 746.92 g/mol. Its IUPAC name is N-[(5S)-5-acetamido-6-amino-6-oxohexyl]-8-[[4-[[(5R)-5-acetamido-6-amino-6-oxohexyl]carbamoyl]quinolin-8-yl]disulfanyl]quinoline-4-carboxamide.
| Compound Name | N-[(5S)-5-acetamido-6-amino-6-oxohexyl]-8-[[4-[[(5R)-5-acetamido-6-amino-6-oxohexyl]carbamoyl]quinolin-8-yl]disulfanyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 90112937 |
| Molecular Formula | C36H42N8O6S2 |
| Molecular Weight | 746.92 g/mol |
| Exact Mass | 746.27 |
| IUPAC Name | N-[(5S)-5-acetamido-6-amino-6-oxohexyl]-8-[[4-[[(5R)-5-acetamido-6-amino-6-oxohexyl]carbamoyl]quinolin-8-yl]disulfanyl]quinoline-4-carboxamide |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)c1ccnc2c(SSc3cccc4c(C(=O)NCCCC[C@@H](NC(C)=O)C(N)=O)ccnc34)cccc12)C(N)=O |
| InChI | InChI=1S/C36H42N8O6S2/c1-21(45)43-27(33(37)47)11-3-5-17-41-35(49)25-15-19-39-31-23(25)9-7-13-29(31)51-52-30-14-8-10-24-26(16-20-40-32(24)30)36(50)42-18-6-4-12-28(34(38)48)44-22(2)46/h7-10,13-16,19-20,27-28H,3-6,11-12,17-18H2,1-2H3,(H2,37,47)(H2,38,48)(H,41,49)(H,42,50)(H,43,45)(H,44,46)/t27-,28+ |
| InChIKey | NUZASZAVIHFDQP-HNRBIFIRSA-N |
| XLogP | 3.36 |
| TPSA | 228.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|