C22H24N2OS2 — CID 74762751
8-(methyldisulfanyl)-N-[2-(2-propan-2-ylphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 74762751) has the molecular formula C22H24N2OS2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 8-(methyldisulfanyl)-N-[2-(2-propan-2-ylphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 8-(methyldisulfanyl)-N-[2-(2-propan-2-ylphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 74762751 |
| Molecular Formula | C22H24N2OS2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 8-(methyldisulfanyl)-N-[2-(2-propan-2-ylphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | CSSc1cccc2c(C(=O)NCCc3ccccc3C(C)C)ccnc12 |
| InChI | InChI=1S/C22H24N2OS2/c1-15(2)17-8-5-4-7-16(17)11-13-24-22(25)19-12-14-23-21-18(19)9-6-10-20(21)27-26-3/h4-10,12,14-15H,11,13H2,1-3H3,(H,24,25) |
| InChIKey | MVLGUIDWUSMRIZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|