C17H22N2O2S2 — CID 90112316
N-(1-methoxy-3-methylbutan-2-yl)-8-(methyldisulfanyl)quinoline-5-carboxamide (PubChem CID 90112316) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-(1-methoxy-3-methylbutan-2-yl)-8-(methyldisulfanyl)quinoline-5-carboxamide.
| Compound Name | N-(1-methoxy-3-methylbutan-2-yl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 90112316 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-(1-methoxy-3-methylbutan-2-yl)-8-(methyldisulfanyl)quinoline-5-carboxamide |
| SMILES | COCC(NC(=O)c1ccc(SSC)c2ncccc12)C(C)C |
| InChI | InChI=1S/C17H22N2O2S2/c1-11(2)14(10-21-3)19-17(20)13-7-8-15(23-22-4)16-12(13)6-5-9-18-16/h5-9,11,14H,10H2,1-4H3,(H,19,20) |
| InChIKey | MLZCOFJFERWXLW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|