C14H22FN3O2 — CID 105386649
2-(ethylamino)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)pyridine-4-carboxamide (PubChem CID 105386649) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386649 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-(1-methoxy-3-methylbutan-2-yl)pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)NC(COC)C(C)C)c1F |
| InChI | InChI=1S/C14H22FN3O2/c1-5-16-13-12(15)10(6-7-17-13)14(19)18-11(8-20-4)9(2)3/h6-7,9,11H,5,8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | AYCCKLMQBXKHOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |