C15H24FN3O2 — CID 105385257
2-(ethylamino)-3-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)pyridine-4-carboxamide (PubChem CID 105385257) has the molecular formula C15H24FN3O2 and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385257 |
| Molecular Formula | C15H24FN3O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)N(CCOC)CC(C)C)c1F |
| InChI | InChI=1S/C15H24FN3O2/c1-5-17-14-13(16)12(6-7-18-14)15(20)19(8-9-21-4)10-11(2)3/h6-7,11H,5,8-10H2,1-4H3,(H,17,18) |
| InChIKey | BPTUKCCGCSVNNJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |