C13H20FN3OS — CID 105387232
2-(ethylamino)-3-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)pyridine-4-carboxamide (PubChem CID 105387232) has the molecular formula C13H20FN3OS and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387232 |
| Molecular Formula | C13H20FN3OS |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)N(C)C(C)CSC)c1F |
| InChI | InChI=1S/C13H20FN3OS/c1-5-15-12-11(14)10(6-7-16-12)13(18)17(3)9(2)8-19-4/h6-7,9H,5,8H2,1-4H3,(H,15,16) |
| InChIKey | WVOJLOOYSMNGFJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |