C18H16N2O4 — CID 18372541
8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]quinoline-7-carboxamide (PubChem CID 18372541) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]quinoline-7-carboxamide.
| Compound Name | 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 18372541 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 8-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]quinoline-7-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc3cccnc3c2O)ccc1O |
| InChI | InChI=1S/C18H16N2O4/c1-24-15-9-11(4-7-14(15)21)10-20-18(23)13-6-5-12-3-2-8-19-16(12)17(13)22/h2-9,21-22H,10H2,1H3,(H,20,23) |
| InChIKey | MUCDXRBWHYGPDT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |