C19H19BrN2O2 — CID 159643443
N-[2-(4-bromophenyl)ethyl]-8-hydroxyquinoline-7-carboxamide;methane (PubChem CID 159643443) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)ethyl]-8-hydroxyquinoline-7-carboxamide;methane.
| Compound Name | N-[2-(4-bromophenyl)ethyl]-8-hydroxyquinoline-7-carboxamide;methane |
|---|---|
| PubChem CID | 159643443 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[2-(4-bromophenyl)ethyl]-8-hydroxyquinoline-7-carboxamide;methane |
| SMILES | C.O=C(NCCc1ccc(Br)cc1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C18H15BrN2O2.CH4/c19-14-6-3-12(4-7-14)9-11-21-18(23)15-8-5-13-2-1-10-20-16(13)17(15)22;/h1-8,10,22H,9,11H2,(H,21,23);1H4 |
| InChIKey | MQQQFHVRTAYLNK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |