C20H22N2O4 — CID 158606160
8-hydroxy-N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]quinoline-7-carboxamide;methane (PubChem CID 158606160) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 8-hydroxy-N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]quinoline-7-carboxamide;methane.
| Compound Name | 8-hydroxy-N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]quinoline-7-carboxamide;methane |
|---|---|
| PubChem CID | 158606160 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 8-hydroxy-N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]quinoline-7-carboxamide;methane |
| SMILES | C.O=C(NC(CO)Cc1ccc(O)cc1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C19H18N2O4.CH4/c22-11-14(10-12-3-6-15(23)7-4-12)21-19(25)16-8-5-13-2-1-9-20-17(13)18(16)24;/h1-9,14,22-24H,10-11H2,(H,21,25);1H4 |
| InChIKey | HWGDOYUXTYHHCB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |