C16H14ClF2NO3 — CID 122147380
4-chloro-2,5-difluoro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]benzamide (PubChem CID 122147380) has the molecular formula C16H14ClF2NO3 and a molecular weight of 341.74 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 122147380 |
| Molecular Formula | C16H14ClF2NO3 |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]benzamide |
| SMILES | O=C(N[C@H](CO)Cc1ccc(O)cc1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C16H14ClF2NO3/c17-13-7-14(18)12(6-15(13)19)16(23)20-10(8-21)5-9-1-3-11(22)4-2-9/h1-4,6-7,10,21-22H,5,8H2,(H,20,23)/t10-/m0/s1 |
| InChIKey | NTIBCWYQIBVBCN-JTQLQIEISA-N |
| XLogP | 2.66 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|