C16H16FNO3 — CID 104696636
2-fluoro-4-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide (PubChem CID 104696636) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 104696636 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccc(O)cc1F |
| InChI | InChI=1S/C16H16FNO3/c17-15-9-13(20)6-7-14(15)16(21)18-12(10-19)8-11-4-2-1-3-5-11/h1-7,9,12,19-20H,8,10H2,(H,18,21) |
| InChIKey | MZCICZPQFDSTGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |