C15H16N2O3 — CID 81442857
3-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)pyridine-4-carboxamide (PubChem CID 81442857) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 81442857 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-hydroxy-N-(1-hydroxy-3-phenylpropan-2-yl)pyridine-4-carboxamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccncc1O |
| InChI | InChI=1S/C15H16N2O3/c18-10-12(8-11-4-2-1-3-5-11)17-15(20)13-6-7-16-9-14(13)19/h1-7,9,12,18-19H,8,10H2,(H,17,20) |
| InChIKey | PRHSWTZTUVHSIG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |