C15H14BrFN2O — CID 114311258
N-(1-bromo-3-phenylpropan-2-yl)-3-fluoropyridine-4-carboxamide (PubChem CID 114311258) has the molecular formula C15H14BrFN2O and a molecular weight of 337.19 g/mol. Its IUPAC name is N-(1-bromo-3-phenylpropan-2-yl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(1-bromo-3-phenylpropan-2-yl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114311258 |
| Molecular Formula | C15H14BrFN2O |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-(1-bromo-3-phenylpropan-2-yl)-3-fluoropyridine-4-carboxamide |
| SMILES | O=C(NC(CBr)Cc1ccccc1)c1ccncc1F |
| InChI | InChI=1S/C15H14BrFN2O/c16-9-12(8-11-4-2-1-3-5-11)19-15(20)13-6-7-18-10-14(13)17/h1-7,10,12H,8-9H2,(H,19,20) |
| InChIKey | UHVBWQOVKWUHQL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|