C11H14BrFN2O2 — CID 106155981
N-(4-bromo-1-methoxybutan-2-yl)-3-fluoropyridine-4-carboxamide (PubChem CID 106155981) has the molecular formula C11H14BrFN2O2 and a molecular weight of 305.15 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 106155981 |
| Molecular Formula | C11H14BrFN2O2 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-3-fluoropyridine-4-carboxamide |
| SMILES | COCC(CCBr)NC(=O)c1ccncc1F |
| InChI | InChI=1S/C11H14BrFN2O2/c1-17-7-8(2-4-12)15-11(16)9-3-5-14-6-10(9)13/h3,5-6,8H,2,4,7H2,1H3,(H,15,16) |
| InChIKey | WKMZSGIBGOFJNY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|