C10H15BrN2O3 — CID 106155964
N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 106155964) has the molecular formula C10H15BrN2O3 and a molecular weight of 291.14 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 106155964 |
| Molecular Formula | C10H15BrN2O3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | COCC(CCBr)NC(=O)c1cnoc1C |
| InChI | InChI=1S/C10H15BrN2O3/c1-7-9(5-12-16-7)10(14)13-8(3-4-11)6-15-2/h5,8H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | MFKLZEJYVRHDPU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|