C10H16BrN3O2 — CID 106156313
N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 106156313) has the molecular formula C10H16BrN3O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106156313 |
| Molecular Formula | C10H16BrN3O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | COCC(CCBr)NC(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C10H16BrN3O2/c1-7-9(5-12-14-7)10(15)13-8(3-4-11)6-16-2/h5,8H,3-4,6H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | ZETSRGLVRBQSNG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|