C18H16Cl2N2O2 — CID 159727206
N-[(2,4-dichlorophenyl)methyl]-8-hydroxyquinoline-7-carboxamide;methane (PubChem CID 159727206) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-8-hydroxyquinoline-7-carboxamide;methane.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-8-hydroxyquinoline-7-carboxamide;methane |
|---|---|
| PubChem CID | 159727206 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-8-hydroxyquinoline-7-carboxamide;methane |
| SMILES | C.O=C(NCc1ccc(Cl)cc1Cl)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C17H12Cl2N2O2.CH4/c18-12-5-3-11(14(19)8-12)9-21-17(23)13-6-4-10-2-1-7-20-15(10)16(13)22;/h1-8,22H,9H2,(H,21,23);1H4 |
| InChIKey | NAUBHFBOIAKZKQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |