C16H17NO5 — CID 146301946
N-[(3-ethoxy-4-hydroxyphenyl)methyl]-2,3-dihydroxybenzamide (PubChem CID 146301946) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is N-[(3-ethoxy-4-hydroxyphenyl)methyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(3-ethoxy-4-hydroxyphenyl)methyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 146301946 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[(3-ethoxy-4-hydroxyphenyl)methyl]-2,3-dihydroxybenzamide |
| SMILES | CCOc1cc(CNC(=O)c2cccc(O)c2O)ccc1O |
| InChI | InChI=1S/C16H17NO5/c1-2-22-14-8-10(6-7-12(14)18)9-17-16(21)11-4-3-5-13(19)15(11)20/h3-8,18-20H,2,9H2,1H3,(H,17,21) |
| InChIKey | KEGAPTLSRGQZLG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|