C14H23N3O3 — CID 83110402
3-[2-[(3-ethoxy-4-hydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83110402) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[2-[(3-ethoxy-4-hydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(3-ethoxy-4-hydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83110402 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[2-[(3-ethoxy-4-hydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CCOc1cc(CNCCNC(=O)N(C)C)ccc1O |
| InChI | InChI=1S/C14H23N3O3/c1-4-20-13-9-11(5-6-12(13)18)10-15-7-8-16-14(19)17(2)3/h5-6,9,15,18H,4,7-8,10H2,1-3H3,(H,16,19) |
| InChIKey | FDOUWHRXCMQDOL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|