C12H17Br2N3O — CID 113483311
3-[2-[(3,4-dibromophenyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 113483311) has the molecular formula C12H17Br2N3O and a molecular weight of 379.10 g/mol. Its IUPAC name is 3-[2-[(3,4-dibromophenyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(3,4-dibromophenyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 113483311 |
| Molecular Formula | C12H17Br2N3O |
| Molecular Weight | 379.10 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 3-[2-[(3,4-dibromophenyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2N3O/c1-17(2)12(18)16-6-5-15-8-9-3-4-10(13)11(14)7-9/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,18) |
| InChIKey | ZIVGPUDHTBRJOW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|