C12H17BrN4O3 — CID 83116397
3-[2-[(4-bromo-3-nitrophenyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83116397) has the molecular formula C12H17BrN4O3 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-[2-[(4-bromo-3-nitrophenyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-bromo-3-nitrophenyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116397 |
| Molecular Formula | C12H17BrN4O3 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-[2-[(4-bromo-3-nitrophenyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17BrN4O3/c1-16(2)12(18)15-6-5-14-8-9-3-4-10(13)11(7-9)17(19)20/h3-4,7,14H,5-6,8H2,1-2H3,(H,15,18) |
| InChIKey | VBWBOJJEGHYMIZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|