C15H24BrN3O2 — CID 43434700
1-N-[(4-bromo-3-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine (PubChem CID 43434700) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-N-[(4-bromo-3-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine.
| Compound Name | 1-N-[(4-bromo-3-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 43434700 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-N-[(4-bromo-3-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(CNCc1ccc(Br)c([N+](=O)[O-])c1)N(C)C |
| InChI | InChI=1S/C15H24BrN3O2/c1-11(2)7-13(18(3)4)10-17-9-12-5-6-14(16)15(8-12)19(20)21/h5-6,8,11,13,17H,7,9-10H2,1-4H3 |
| InChIKey | GLJJVILPACMWMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|