C13H17F4N3O — CID 83112303
3-[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83112303) has the molecular formula C13H17F4N3O and a molecular weight of 307.29 g/mol. Its IUPAC name is 3-[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83112303 |
| Molecular Formula | C13H17F4N3O |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F4N3O/c1-20(2)12(21)19-6-5-18-8-9-3-4-11(14)10(7-9)13(15,16)17/h3-4,7,18H,5-6,8H2,1-2H3,(H,19,21) |
| InChIKey | MPKDUCGHXQIXTG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|