C11H18BrN3OS — CID 102837191
3-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 102837191) has the molecular formula C11H18BrN3OS and a molecular weight of 320.26 g/mol. Its IUPAC name is 3-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 102837191 |
| Molecular Formula | C11H18BrN3OS |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | Cc1sc(CNCCNC(=O)N(C)C)cc1Br |
| InChI | InChI=1S/C11H18BrN3OS/c1-8-10(12)6-9(17-8)7-13-4-5-14-11(16)15(2)3/h6,13H,4-5,7H2,1-3H3,(H,14,16) |
| InChIKey | PETFDRJPHLHFTB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|