C10H16BrNO2S — CID 102831297
2-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethoxy]ethanol (PubChem CID 102831297) has the molecular formula C10H16BrNO2S and a molecular weight of 294.21 g/mol. Its IUPAC name is 2-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 102831297 |
| Molecular Formula | C10H16BrNO2S |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-[2-[(4-bromo-5-methylthiophen-2-yl)methylamino]ethoxy]ethanol |
| SMILES | Cc1sc(CNCCOCCO)cc1Br |
| InChI | InChI=1S/C10H16BrNO2S/c1-8-10(11)6-9(15-8)7-12-2-4-14-5-3-13/h6,12-13H,2-5,7H2,1H3 |
| InChIKey | BIRLXSZMOYUBSO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|