C10H14BrNOS — CID 102837729
[1-[(4-bromo-5-methylthiophen-2-yl)methylamino]cyclopropyl]methanol (PubChem CID 102837729) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is [1-[(4-bromo-5-methylthiophen-2-yl)methylamino]cyclopropyl]methanol.
| Compound Name | [1-[(4-bromo-5-methylthiophen-2-yl)methylamino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 102837729 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | [1-[(4-bromo-5-methylthiophen-2-yl)methylamino]cyclopropyl]methanol |
| SMILES | Cc1sc(CNC2(CO)CC2)cc1Br |
| InChI | InChI=1S/C10H14BrNOS/c1-7-9(11)4-8(14-7)5-12-10(6-13)2-3-10/h4,12-13H,2-3,5-6H2,1H3 |
| InChIKey | RJRIUBRFCRPSSB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |