C10H16ClN3OS — CID 83115789
3-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83115789) has the molecular formula C10H16ClN3OS and a molecular weight of 261.78 g/mol. Its IUPAC name is 3-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83115789 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1cc(Cl)cs1 |
| InChI | InChI=1S/C10H16ClN3OS/c1-14(2)10(15)13-4-3-12-6-9-5-8(11)7-16-9/h5,7,12H,3-4,6H2,1-2H3,(H,13,15) |
| InChIKey | HALLUOKYZTXGFR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|