C15H25ClN2O3S — CID 107257286
tert-butyl N-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-N-(2-hydroxypropyl)carbamate (PubChem CID 107257286) has the molecular formula C15H25ClN2O3S and a molecular weight of 348.90 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-N-(2-hydroxypropyl)carbamate.
| Compound Name | tert-butyl N-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-N-(2-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 107257286 |
| Molecular Formula | C15H25ClN2O3S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl N-[2-[(4-chlorothiophen-2-yl)methylamino]ethyl]-N-(2-hydroxypropyl)carbamate |
| SMILES | CC(O)CN(CCNCc1cc(Cl)cs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25ClN2O3S/c1-11(19)9-18(14(20)21-15(2,3)4)6-5-17-8-13-7-12(16)10-22-13/h7,10-11,17,19H,5-6,8-9H2,1-4H3 |
| InChIKey | RGVIKZRYVBOINE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|