C15H25N3O5S — CID 114078129
tert-butyl N-(2-hydroxypropyl)-N-[2-[(5-nitrothiophen-2-yl)methylamino]ethyl]carbamate (PubChem CID 114078129) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxypropyl)-N-[2-[(5-nitrothiophen-2-yl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxypropyl)-N-[2-[(5-nitrothiophen-2-yl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 114078129 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | tert-butyl N-(2-hydroxypropyl)-N-[2-[(5-nitrothiophen-2-yl)methylamino]ethyl]carbamate |
| SMILES | CC(O)CN(CCNCc1ccc([N+](=O)[O-])s1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O5S/c1-11(19)10-17(14(20)23-15(2,3)4)8-7-16-9-12-5-6-13(24-12)18(21)22/h5-6,11,16,19H,7-10H2,1-4H3 |
| InChIKey | DKHIIXUAGWNVAV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|