C16H28N2O4 — CID 107257084
tert-butyl N-[2-[1-(furan-3-yl)ethylamino]ethyl]-N-(2-hydroxypropyl)carbamate (PubChem CID 107257084) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(furan-3-yl)ethylamino]ethyl]-N-(2-hydroxypropyl)carbamate.
| Compound Name | tert-butyl N-[2-[1-(furan-3-yl)ethylamino]ethyl]-N-(2-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 107257084 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | tert-butyl N-[2-[1-(furan-3-yl)ethylamino]ethyl]-N-(2-hydroxypropyl)carbamate |
| SMILES | CC(O)CN(CCNC(C)c1ccoc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-12(19)10-18(15(20)22-16(3,4)5)8-7-17-13(2)14-6-9-21-11-14/h6,9,11-13,17,19H,7-8,10H2,1-5H3 |
| InChIKey | KLGZDNDQPVEQFL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |