C7H11ClN2S — CID 83006847
2-[(4-chlorothiophen-2-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 83006847) has the molecular formula C7H11ClN2S and a molecular weight of 190.70 g/mol. Its IUPAC name is 2-[(4-chlorothiophen-2-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(4-chlorothiophen-2-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83006847 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2-[(4-chlorothiophen-2-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1cc(Cl)cs1 |
| InChI | InChI=1S/C7H11ClN2S/c1-10(2)9-4-7-3-6(8)5-11-7/h3,5,9H,4H2,1-2H3 |
| InChIKey | RRVYQJVIECYSDX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|