C9H14ClNO2S — CID 79419390
N-[(4-chlorothiophen-2-yl)methyl]-2,2-dimethoxyethanamine (PubChem CID 79419390) has the molecular formula C9H14ClNO2S and a molecular weight of 235.74 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 79419390 |
| Molecular Formula | C9H14ClNO2S |
| Molecular Weight | 235.74 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNCc1cc(Cl)cs1)OC |
| InChI | InChI=1S/C9H14ClNO2S/c1-12-9(13-2)5-11-4-8-3-7(10)6-14-8/h3,6,9,11H,4-5H2,1-2H3 |
| InChIKey | WSWDOCSZXPXTID-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|