C8H10ClNS — CID 79420637
N-[(4-chlorothiophen-2-yl)methyl]prop-2-en-1-amine (PubChem CID 79420637) has the molecular formula C8H10ClNS and a molecular weight of 187.70 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79420637 |
| Molecular Formula | C8H10ClNS |
| Molecular Weight | 187.70 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cc(Cl)cs1 |
| InChI | InChI=1S/C8H10ClNS/c1-2-3-10-5-8-4-7(9)6-11-8/h2,4,6,10H,1,3,5H2 |
| InChIKey | AIKUHHYVKHUBFB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|