C16H16FNO3 — CID 114344540
N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3-dihydroxybenzamide (PubChem CID 114344540) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344540 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3-dihydroxybenzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc(O)c2O)cc(C)c1F |
| InChI | InChI=1S/C16H16FNO3/c1-9-6-11(7-10(2)14(9)17)8-18-16(21)12-4-3-5-13(19)15(12)20/h3-7,19-20H,8H2,1-2H3,(H,18,21) |
| InChIKey | ANKVSRBRGUOFDF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|