C17H22N4O3 — CID 174936365
[2-methyl-4-[4-[(1H-pyrazole-4-carbonylamino)methyl]phenyl]butan-2-yl] carbamate (PubChem CID 174936365) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is [2-methyl-4-[4-[(1H-pyrazole-4-carbonylamino)methyl]phenyl]butan-2-yl] carbamate.
| Compound Name | [2-methyl-4-[4-[(1H-pyrazole-4-carbonylamino)methyl]phenyl]butan-2-yl] carbamate |
|---|---|
| PubChem CID | 174936365 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [2-methyl-4-[4-[(1H-pyrazole-4-carbonylamino)methyl]phenyl]butan-2-yl] carbamate |
| SMILES | CC(C)(CCc1ccc(CNC(=O)c2cn[nH]c2)cc1)OC(N)=O |
| InChI | InChI=1S/C17H22N4O3/c1-17(2,24-16(18)23)8-7-12-3-5-13(6-4-12)9-19-15(22)14-10-20-21-11-14/h3-6,10-11H,7-9H2,1-2H3,(H2,18,23)(H,19,22)(H,20,21) |
| InChIKey | DRQYFLZYNWVERM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |