C11H10ClN3O3S — CID 55179604
4-[(1H-pyrazole-4-carbonylamino)methyl]benzenesulfonyl chloride (PubChem CID 55179604) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is 4-[(1H-pyrazole-4-carbonylamino)methyl]benzenesulfonyl chloride.
| Compound Name | 4-[(1H-pyrazole-4-carbonylamino)methyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 55179604 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 4-[(1H-pyrazole-4-carbonylamino)methyl]benzenesulfonyl chloride |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Cl)cc1)c1cn[nH]c1 |
| InChI | InChI=1S/C11H10ClN3O3S/c12-19(17,18)10-3-1-8(2-4-10)5-13-11(16)9-6-14-15-7-9/h1-4,6-7H,5H2,(H,13,16)(H,14,15) |
| InChIKey | UTJRQXHVDDEKSR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |