C12H14N4O3S — CID 47252542
1-[(4-methylsulfonylphenyl)methyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 47252542) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[(4-methylsulfonylphenyl)methyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(4-methylsulfonylphenyl)methyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 47252542 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[(4-methylsulfonylphenyl)methyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)Nc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C12H14N4O3S/c1-20(18,19)11-4-2-9(3-5-11)6-13-12(17)16-10-7-14-15-8-10/h2-5,7-8H,6H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | DTQHVFYRFZCGTE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |