C12H14N4O3 — CID 47248167
1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 47248167) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 47248167 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | COc1cc(CNC(=O)Nc2cn[nH]c2)ccc1O |
| InChI | InChI=1S/C12H14N4O3/c1-19-11-4-8(2-3-10(11)17)5-13-12(18)16-9-6-14-15-7-9/h2-4,6-7,17H,5H2,1H3,(H,14,15)(H2,13,16,18) |
| InChIKey | QTJABDQOJCWBFC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |