C24H22N4O3S — CID 135223155
1-[4-[2-(2-methylphenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea (PubChem CID 135223155) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[4-[2-(2-methylphenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea.
| Compound Name | 1-[4-[2-(2-methylphenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135223155 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[4-[2-(2-methylphenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
| SMILES | Cc1ccccc1-c1ccccc1S(=O)(=O)c1ccc(NC(=O)NCc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-17-6-2-3-7-21(17)22-8-4-5-9-23(22)32(30,31)20-12-10-19(11-13-20)28-24(29)25-14-18-15-26-27-16-18/h2-13,15-16H,14H2,1H3,(H,26,27)(H2,25,28,29) |
| InChIKey | UQHYBYKKOBZRLM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |