C9H9BrN4OS — CID 47253712
1-[(5-bromothiophen-3-yl)methyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 47253712) has the molecular formula C9H9BrN4OS and a molecular weight of 301.17 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 47253712 |
| Molecular Formula | C9H9BrN4OS |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | O=C(NCc1csc(Br)c1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C9H9BrN4OS/c10-8-1-6(5-16-8)2-11-9(15)14-7-3-12-13-4-7/h1,3-5H,2H2,(H,12,13)(H2,11,14,15) |
| InChIKey | YCSVZNDJSTZBOS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |