C6H8F2N4O — CID 130991878
1-(2,2-difluoroethyl)-3-(1H-pyrazol-4-yl)urea (PubChem CID 130991878) has the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-(2,2-difluoroethyl)-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 130991878 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(1H-pyrazol-4-yl)urea |
| SMILES | O=C(NCC(F)F)Nc1cn[nH]c1 |
| InChI | InChI=1S/C6H8F2N4O/c7-5(8)3-9-6(13)12-4-1-10-11-2-4/h1-2,5H,3H2,(H,10,11)(H2,9,12,13) |
| InChIKey | FAMBERXZDIATTE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |