C13H16N4O3 — CID 94174229
1-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 94174229) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 94174229 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | COc1ccc([C@H](O)CNC(=O)Nc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C13H16N4O3/c1-20-11-4-2-9(3-5-11)12(18)8-14-13(19)17-10-6-15-16-7-10/h2-7,12,18H,8H2,1H3,(H,15,16)(H2,14,17,19)/t12-/m1/s1 |
| InChIKey | MVCQPFLAPIXRDQ-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |