C14H18N4O3 — CID 94177078
1-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea (PubChem CID 94177078) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea.
| Compound Name | 1-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 94177078 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea |
| SMILES | COc1ccc([C@@H](O)CNC(=O)NCc2ccn[nH]2)cc1 |
| InChI | InChI=1S/C14H18N4O3/c1-21-12-4-2-10(3-5-12)13(19)9-16-14(20)15-8-11-6-7-17-18-11/h2-7,13,19H,8-9H2,1H3,(H,17,18)(H2,15,16,20)/t13-/m0/s1 |
| InChIKey | JMAQYKPDPIVXTQ-ZDUSSCGKSA-N |
| XLogP | 0.95 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |