C15H20N4O3 — CID 51084955
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea (PubChem CID 51084955) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 51084955 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-pyrazol-5-ylmethyl)urea |
| SMILES | COc1ccc(C(C)NC(=O)NCc2ccn[nH]2)cc1OC |
| InChI | InChI=1S/C15H20N4O3/c1-10(11-4-5-13(21-2)14(8-11)22-3)18-15(20)16-9-12-6-7-17-19-12/h4-8,10H,9H2,1-3H3,(H,17,19)(H2,16,18,20) |
| InChIKey | DZPWZYIXRQEUGW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |