C22H32N6O3 — CID 55792466
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea (PubChem CID 55792466) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 55792466 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCCCN2CCN(c3ncccn3)CC2)cc1OC |
| InChI | InChI=1S/C22H32N6O3/c1-17(18-6-7-19(30-2)20(16-18)31-3)26-22(29)25-10-5-11-27-12-14-28(15-13-27)21-23-8-4-9-24-21/h4,6-9,16-17H,5,10-15H2,1-3H3,(H2,25,26,29) |
| InChIKey | HIIHXNGDBTXIIF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|