C23H27FN6OS — CID 55575073
1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea (PubChem CID 55575073) has the molecular formula C23H27FN6OS and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 55575073 |
| Molecular Formula | C23H27FN6OS |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C23H27FN6OS/c24-19-7-5-18(6-8-19)21(20-4-1-17-32-20)28-23(31)27-11-3-12-29-13-15-30(16-14-29)22-25-9-2-10-26-22/h1-2,4-10,17,21H,3,11-16H2,(H2,27,28,31) |
| InChIKey | GDHFTDPESHPWOA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|