C14H15F3N4O2 — CID 94030672
1-(1H-pyrazol-5-ylmethyl)-3-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]urea (PubChem CID 94030672) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylmethyl)-3-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]urea.
| Compound Name | 1-(1H-pyrazol-5-ylmethyl)-3-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 94030672 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(1H-pyrazol-5-ylmethyl)-3-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]urea |
| SMILES | C[C@@H](NC(=O)NCc1ccn[nH]1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N4O2/c1-9(20-13(22)18-8-11-6-7-19-21-11)10-2-4-12(5-3-10)23-14(15,16)17/h2-7,9H,8H2,1H3,(H,19,21)(H2,18,20,22)/t9-/m1/s1 |
| InChIKey | JZIYZXFLNWVSPM-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |