C12H14N4O2 — CID 61341794
1-[4-(1-hydroxyethyl)phenyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 61341794) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 61341794 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | CC(O)c1ccc(NC(=O)Nc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C12H14N4O2/c1-8(17)9-2-4-10(5-3-9)15-12(18)16-11-6-13-14-7-11/h2-8,17H,1H3,(H,13,14)(H2,15,16,18) |
| InChIKey | QPVJKJQXXHADDA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |